Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == * smiles: ** C(C5(OC(OC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241] ==
* smiles:
+
* taxonomic range:
** C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
+
 
* common name:
 
* common name:
** luteolin 7-O-β-D-diglucuronide
+
** myo-inositol degradation II
* molecular weight:
+
** 636.476   
+
 
* Synonym(s):
 
* Synonym(s):
** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-15288]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-01_006070]]
 +
*** [[Ec-07_006540]]
 +
*** [[Ec-18_003270]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14358 RXN-14358]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14359 RXN-14359]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14360 RXN-14360]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14362 RXN-14362]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878427 46878427]
+
{{#set: common name=myo-inositol degradation II}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57815 57815]
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=20.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C12632 C12632]
+
* HMDB : HMDB60297
+
{{#set: smiles=C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O}}
+
{{#set: inchi key=InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L}}
+
{{#set: common name=luteolin 7-O-β-D-diglucuronide}}
+
{{#set: molecular weight=636.476    }}
+
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]}}
+
{{#set: consumed by=RXN-15288}}
+

Revision as of 20:25, 17 March 2018

Pathway PWY-7241

  • taxonomic range:
  • common name:
    • myo-inositol degradation II
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links