Difference between revisions of "PWY-3722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == * smiles: ** C(C1(C(=CC=CC=1)NC=O))=O * inchi key: ** InChIKey=PVIMSPYDDGDC...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(=CC=CC=1)NC=O))=O |
| + | * inchi key: | ||
| + | ** InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-formylaminobenzaldehyde |
| + | * molecular weight: | ||
| + | ** 149.149 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[INDOLE-23-DIOXYGENASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=400 400] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389.html 389] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18033 18033] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03574 C03574] | ||
| + | {{#set: smiles=C(C1(C(=CC=CC=1)NC=O))=O}} | ||
| + | {{#set: inchi key=InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=2-formylaminobenzaldehyde}} | ||
| + | {{#set: molecular weight=149.149 }} | ||
| + | {{#set: produced by=INDOLE-23-DIOXYGENASE-RXN}} | ||
Revision as of 20:26, 17 March 2018
Contents
Metabolite CPD-248
- smiles:
- C(C1(C(=CC=CC=1)NC=O))=O
- inchi key:
- InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N
- common name:
- 2-formylaminobenzaldehyde
- molecular weight:
- 149.149
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
