Difference between revisions of "Dodecanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == |
| + | * smiles: | ||
| + | ** C(CC([N+])C(=O)[O-])ONC(=[N+])N | ||
| + | * inchi key: | ||
| + | ** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O | ||
* common name: | * common name: | ||
| − | ** | + | ** L-canavanine |
| + | * molecular weight: | ||
| + | ** 177.183 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** canavanine |
| − | ** | + | ** 2-amino-4-(guanidinooxy)butyrate |
| + | ** 2-amino-4-(guanidinooxy)butyric acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-34]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-22]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 543-38-4 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185] |
| − | {{#set: produced by=RXN- | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308] | ||
| + | * HMDB : HMDB02706 | ||
| + | {{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}} | ||
| + | {{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}} | ||
| + | {{#set: common name=L-canavanine}} | ||
| + | {{#set: molecular weight=177.183 }} | ||
| + | {{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}} | ||
| + | {{#set: consumed by=RXN-34}} | ||
| + | {{#set: produced by=RXN-22}} | ||
Revision as of 20:26, 17 March 2018
Contents
Metabolite CANAVANINE
- smiles:
- C(CC([N+])C(=O)[O-])ONC(=[N+])N
- inchi key:
- InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
- common name:
- L-canavanine
- molecular weight:
- 177.183
- Synonym(s):
- canavanine
- 2-amino-4-(guanidinooxy)butyrate
- 2-amino-4-(guanidinooxy)butyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.
