Difference between revisions of "RXN-5861"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common name: ** an apo-[VibB aryl-carrier protein] * Synonym(s): == Reaction(s...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an apo-[VibB aryl-carrier protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-10994]] |
== External links == | == External links == | ||
− | + | {{#set: common name=an apo-[VibB aryl-carrier protein]}} | |
− | + | {{#set: reversible reaction associated=RXN-10994}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 20:26, 17 March 2018
Contents
Metabolite VibB
- common name:
- an apo-[VibB aryl-carrier protein]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an apo-[VibB aryl-carrier protein" cannot be used as a page name in this wiki.