Difference between revisions of "2.7.13.3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17640 CPD-17640] == * smiles: ** C(O)CCCCCCCCCCCCCCCCC([O-])=O * inchi key: ** InChIKey=VLH...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17640 CPD-17640] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)CCCCCCCCCCCCCCCCC([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VLHZUYUOEGBBJB-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 18-hydroxystearate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 299.473 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 18-hydroxyoctadecanoate |
+ | ** 18-hydroxyoctadecanoic acid | ||
+ | ** 18-hydroxystearic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16401]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21891501 21891501] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86046 86046] |
− | + | {{#set: smiles=C(O)CCCCCCCCCCCCCCCCC([O-])=O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=VLHZUYUOEGBBJB-UHFFFAOYSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=18-hydroxystearate}} |
− | {{#set: common name= | + | {{#set: molecular weight=299.473 }} |
− | {{#set: molecular weight= | + | {{#set: common name=18-hydroxyoctadecanoate|18-hydroxyoctadecanoic acid|18-hydroxystearic acid}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-16401}} |
− | {{#set: | + |
Revision as of 20:26, 17 March 2018
Contents
Metabolite CPD-17640
- smiles:
- C(O)CCCCCCCCCCCCCCCCC([O-])=O
- inchi key:
- InChIKey=VLHZUYUOEGBBJB-UHFFFAOYSA-M
- common name:
- 18-hydroxystearate
- molecular weight:
- 299.473
- Synonym(s):
- 18-hydroxyoctadecanoate
- 18-hydroxyoctadecanoic acid
- 18-hydroxystearic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)CCCCCCCCCCCCCCCCC([O-])=O" cannot be used as a page name in this wiki.