Difference between revisions of "FORMYLTHFDEFORMYL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** caffeine degradation III (bacteria, via demethylation) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** caffeine degradation (bacteria) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''7''' reactions in the full pathway | |
− | * [[ | + | * [[RXN0-901]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-20_000230]] |
− | * [[RXN- | + | *** [[Ec-20_000210]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[XANTHINE-OXIDASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-20_000210]] | ||
+ | *** [[Ec-20_000230]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11513 RXN-11513] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11516 RXN-11516] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11517 RXN-11517] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11518 RXN-11518] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13106 RXN-13106] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-MAP: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00232 map00232] |
− | * | + | * UM-BBD-PWY : caf |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | {{#set: | + | {{#set: common name=caffeine degradation III (bacteria, via demethylation)}} |
− | {{#set: | + | {{#set: common name=caffeine degradation (bacteria)}} |
− | {{#set: common name= | + | {{#set: reaction found=2}} |
− | {{#set: | + | {{#set: total reaction=7}} |
− | + | {{#set: completion rate=29.0}} | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:27, 17 March 2018
Pathway PWY-6538
- taxonomic range:
- common name:
- caffeine degradation III (bacteria, via demethylation)
- Synonym(s):
- caffeine degradation (bacteria)
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- RXN0-901
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- XANTHINE-OXIDASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP:
- UM-BBD-PWY : caf