Difference between revisions of "P105-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* common name: | * common name: | ||
| − | ** | + | ** fatty acid α-oxidation II |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN66- | + | '''4''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[RXN66-469]] | |
| − | * [[ | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-02_006430]] |
| + | *** [[Ec-12_008720]] | ||
| + | *** [[Ec-01_001560]] | ||
| + | *** [[Ec-03_003710]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN66-470]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Ec-01_001740]] | ||
| + | *** [[Ec-22_003660]] | ||
| + | *** [[Ec-23_003040]] | ||
| + | *** [[Ec-01_011990]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN66-472]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN66-483]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Ec-12_008720]] | ||
| + | *** [[Ec-03_003710]] | ||
| + | *** [[Ec-02_006430]] | ||
| + | *** [[Ec-01_001560]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA-HYDROLASE-RXN FORMYL-COA-HYDROLASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-471 RXN66-471] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: common name=fatty acid α-oxidation II}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Revision as of 20:28, 17 March 2018
Pathway PWY66-387
- taxonomic range:
- common name:
- fatty acid α-oxidation II
- Synonym(s):
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- RXN66-469
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN66-470
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN66-472
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN66-483
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
