Difference between revisions of "PWY-5532"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
| − | ** | + | ** phospholipases |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** phospholipase pathway | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[3.1.4.11-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-27_005750]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PHOSCHOL-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-08_003110]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PHOSPHOLIPASE-A1-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PHOSPHOLIPASE-C-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOLIPASE-A2-RXN PHOSPHOLIPASE-A2-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY] |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
| − | {{#set: common name= | + | {{#set: common name=phospholipases}} |
| − | {{#set: | + | {{#set: common name=phospholipase pathway}} |
| − | {{#set: | + | {{#set: reaction found=4}} |
| + | {{#set: total reaction=5}} | ||
| + | {{#set: completion rate=80.0}} | ||
Revision as of 21:28, 17 March 2018
Pathway LIPASYN-PWY
- taxonomic range:
- common name:
- phospholipases
- Synonym(s):
- phospholipase pathway
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- 3.1.4.11-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSCHOL-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSPHOLIPASE-A1-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- PHOSPHOLIPASE-C-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
