Difference between revisions of "PWY-5826"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Gene == Gene Ec-26_000800 == * left end position: ** 1244196 * transcription direction: ** NEGATIVE * right end position: ** 1252755 * centisome position: ** 18.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_000800 == |
− | * | + | * left end position: |
− | ** | + | ** 1244196 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1252755 |
− | * | + | * centisome position: |
− | ** | + | ** 18.899137 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0137_0084 |
− | ** | + | ** Esi0137_0084 |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.5.1.19-RXN]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-6163]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1244196}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1252755}} | |
− | + | {{#set: centisome position=18.899137 }} | |
− | + | {{#set: common name=Esi_0137_0084|Esi0137_0084}} | |
− | + | {{#set: reaction associated=2.5.1.19-RXN}} | |
− | + | {{#set: pathway associated=PWY-6163}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:29, 17 March 2018
Gene Ec-26_000800
- left end position:
- 1244196
- transcription direction:
- NEGATIVE
- right end position:
- 1252755
- centisome position:
- 18.899137
- Synonym(s):
- Esi_0137_0084
- Esi0137_0084
Reactions associated
- 2.5.1.19-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome