Difference between revisions of "DADP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12726 RXN-12726] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase beta su...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12726 RXN-12726] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
 
* common name:
 
* common name:
−
** Tryptophan synthase beta subunit-like PLP-dependent enzyme
+
** avenasterol
−
** Cysteine synthase
+
* molecular weight:
−
* ec number:
+
** 412.698   
−
** [http://enzyme.expasy.org/EC/2.5.1.47 EC-2.5.1.47]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-4209]]
−
** 1 [[ACETYLSERINE]][c] '''+''' 1 [[CPD-678]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[L-SELENOCYSTEINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 O-acetyl-L-serine[c] '''+''' 1 hydrogen selenide[c] '''=>''' 1 H+[c] '''+''' 1 acetate[c] '''+''' 1 L-selenocysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_011260]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-01_012080]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-00_008830]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245230 25245230]
−
{{#set: common name=Cysteine synthase}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.5.1.47}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
−
{{#set: gene associated=Ec-01_011260|Ec-01_012080|Ec-00_008830}}
+
* HMDB : HMDB06851
−
{{#set: in pathway=PWY-6936}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=avenasterol}}
−
{{#set: reconstruction source=aragem}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-4209}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:30, 17 March 2018

Metabolite CPD-4125

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
  • common name:
    • avenasterol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DADP&oldid=9196"