Difference between revisions of "CPD-9973"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] == * direction: ** LEFT-TO-RIGHT * common name: ** Peroxiredoxin, AhpC-type **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Peroxiredoxin, AhpC-type |
− | * | + | ** peroxiredoxin |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.11.1.15 EC-1.11.1.15] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[Alkyl-Hydro-Peroxides]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Alcohols]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[WATER]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 an organic hydroperoxide[c] '''+''' 1 a reduced thioredoxin[c] '''=>''' 1 an alcohol[c] '''+''' 1 an oxidized thioredoxin[c] '''+''' 1 H2O[c] | |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * [[Ec-01_002340]] |
− | * [[ | + | ** ESILICULOSUS_GENOME |
+ | ***GO-TERM | ||
+ | * [[Ec-21_005650]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Peroxiredoxin, AhpC-type}} | |
− | + | {{#set: common name=peroxiredoxin}} | |
− | + | {{#set: ec number=EC-1.11.1.15}} | |
− | + | {{#set: gene associated=Ec-01_002340|Ec-21_005650}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:31, 17 March 2018
Contents
Reaction RXN0-5468
- direction:
- LEFT-TO-RIGHT
- common name:
- Peroxiredoxin, AhpC-type
- peroxiredoxin
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Alkyl-Hydro-Peroxides[c] + 1 Red-Thioredoxin[c] => 1 Alcohols[c] + 1 Ox-Thioredoxin[c] + 1 WATER[c]
- With common name(s):
- 1 an organic hydroperoxide[c] + 1 a reduced thioredoxin[c] => 1 an alcohol[c] + 1 an oxidized thioredoxin[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-01_002340
- ESILICULOSUS_GENOME
- GO-TERM
- ESILICULOSUS_GENOME
- Ec-21_005650
- ESILICULOSUS_GENOME
- AUTOMATED-NAME-MATCH
- ESILICULOSUS_GENOME
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome