Difference between revisions of "CPD-9973"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] == * direction: ** LEFT-TO-RIGHT * common name: ** Peroxiredoxin, AhpC-type **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] ==
−
* smiles:
+
* direction:
−
** C(CC(C(=O)[O-])[N+])(N)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
+
 
* common name:
 
* common name:
−
** L-asparagine
+
** Peroxiredoxin, AhpC-type
−
* molecular weight:
+
** peroxiredoxin
−
** 132.119   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.15 EC-1.11.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** asparagine
 
−
** α-aminosuccinamic acid
 
−
** (-)-asparagine
 
−
** (S)-2,4-diamino-4-oxobutanoic acid
 
−
** (S)-asparagine
 
−
** 2,4-diamino-4-oxobutanoic acid, (S)-
 
−
** 2-aminosuccinamic acid, L-
 
−
** agedoite
 
−
** altheine
 
−
** asparagine acid
 
−
** aspartic acid β-amide
 
−
** butanoic acid, 2,4-diamino-4-oxo-, (S)-
 
−
** L-2,4-diamino-4-oxobutanoic acid
 
−
** L-asparatamine
 
−
** L-β-asparagine
 
−
** asn
 
−
** N
 
−
** L-asn
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ASPARAGHYD-RXN]]
+
* With identifiers:
−
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
+
** 1 [[Alkyl-Hydro-Peroxides]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Alcohols]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[WATER]][c]
−
* [[biomass_rxn]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 an organic hydroperoxide[c] '''+''' 1 a reduced thioredoxin[c] '''=>''' 1 an alcohol[c] '''+''' 1 an oxidized thioredoxin[c] '''+''' 1 H2O[c]
−
* [[RXN-12460]]
+
 
−
* [[ASNSYNA-RXN]]
+
== Genes associated with this reaction  ==
−
* [[ASNSYNB-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* [[Ec-01_002340]]
−
* [[2.6.1.14-RXN-P-HYDROXY-PHENYLPYRUVATE/ASN//2-OXOSUCCINAMATE/TYR.51.]]
+
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
* [[Ec-21_005650]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 70-47-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 34055
+
{{#set: common name=Peroxiredoxin, AhpC-type}}
−
* PUBCHEM:
+
{{#set: common name=peroxiredoxin}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992089 6992089]
+
{{#set: ec number=EC-1.11.1.15}}
−
* HMDB : HMDB00168
+
{{#set: gene associated=Ec-01_002340|Ec-21_005650}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00152 C00152]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58048 58048]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC58048
+
−
{{#set: smiles=C(CC(C(=O)[O-])[N+])(N)=O}}
+
−
{{#set: inchi key=InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N}}
+
−
{{#set: common name=L-asparagine}}
+
−
{{#set: molecular weight=132.119    }}
+
−
{{#set: common name=asparagine|α-aminosuccinamic acid|(-)-asparagine|(S)-2,4-diamino-4-oxobutanoic acid|(S)-asparagine|2,4-diamino-4-oxobutanoic acid, (S)-|2-aminosuccinamic acid, L-|agedoite|altheine|asparagine acid|aspartic acid β-amide|butanoic acid, 2,4-diamino-4-oxo-, (S)-|L-2,4-diamino-4-oxobutanoic acid|L-asparatamine|L-β-asparagine|asn|N|L-asn}}
+
−
{{#set: consumed by=ASPARAGHYD-RXN|ASPARAGINE--TRNA-LIGASE-RXN|biomass_rxn}}
+
−
{{#set: produced by=RXN-12460|ASNSYNA-RXN|ASNSYNB-RXN}}
+
−
{{#set: consumed or produced by=2.6.1.14-RXN-P-HYDROXY-PHENYLPYRUVATE/ASN//2-OXOSUCCINAMATE/TYR.51.}}
+

Revision as of 21:31, 17 March 2018

Reaction RXN0-5468

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Peroxiredoxin, AhpC-type
    • peroxiredoxin
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-9973&oldid=9258"