Difference between revisions of "Ec-20 001390"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC...")
 
(Created page with "Category:Gene == Gene Ec-19_001460 == * left end position: ** 1619734 * transcription direction: ** NEGATIVE * right end position: ** 1622128 * centisome position: ** 27.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+
== Gene Ec-19_001460 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 1619734
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (E)-2-benzylidenesuccinyl-CoA
+
** 1622128
−
* molecular weight:
+
* centisome position:
−
** 950.677    
+
** 27.128098    
 
* Synonym(s):
 
* Synonym(s):
−
** E-phenylitaconyl-CoA
+
** Esi_0121_0045
 +
** Esi0121_0045
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-902]]
+
* [[RXN0-2601]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1619734}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986140 50986140]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1622128}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27639 27639]
+
{{#set: centisome position=27.128098   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0121_0045|Esi0121_0045}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09818 C09818]
+
{{#set: reaction associated=RXN0-2601}}
−
* HMDB : HMDB12223
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I}}
+
−
{{#set: common name=(E)-2-benzylidenesuccinyl-CoA}}
+
−
{{#set: molecular weight=950.677   }}
+
−
{{#set: common name=E-phenylitaconyl-CoA}}
+
−
{{#set: consumed by=RXN-902}}
+

Revision as of 20:32, 17 March 2018

Gene Ec-19_001460

  • left end position:
    • 1619734
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1622128
  • centisome position:
    • 27.128098
  • Synonym(s):
    • Esi_0121_0045
    • Esi0121_0045

Reactions associated

  • RXN0-2601
    • esiliculosus_genome
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_001390&oldid=9325"