Difference between revisions of "RXN-6883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-biotin-monomers BCCP-biotin-monomers] == * common name: ** a biotinylated [BCCP monomer] *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-biotin-monomers BCCP-biotin-monomers] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a biotinylated [BCCP monomer] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a biotinylated [biotin-carboxyl-carrier protein monomer] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7101]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[BIOTINLIG-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a biotinylated [BCCP monomer]}} | |
| − | + | {{#set: common name=a biotinylated [biotin-carboxyl-carrier protein monomer]}} | |
| − | + | {{#set: consumed by=RXN-7101}} | |
| − | + | {{#set: produced by=BIOTINLIG-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 20:33, 17 March 2018
Contents
Metabolite BCCP-biotin-monomers
- common name:
- a biotinylated [BCCP monomer]
- Synonym(s):
- a biotinylated [biotin-carboxyl-carrier protein monomer]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a biotinylated [BCCP monomer" cannot be used as a page name in this wiki.
"a biotinylated [biotin-carboxyl-carrier protein monomer" cannot be used as a page name in this wiki.
