Difference between revisions of "SULFO-CYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * smiles: ** C(CC([N+])C(=O)[O-])ON * inchi key: ** InChIKey=FQPGMQAB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (+)-dihydromyricetin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 319.247 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (+)-ampelopsin |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8450]] |
| + | * [[RXN-7784]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7922]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244375 25244375] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429] | ||
| + | * METABOLIGHTS : MTBLC28429 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906] |
| − | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(+)-dihydromyricetin}} |
| − | {{#set: common name= | + | {{#set: molecular weight=319.247 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=(+)-ampelopsin}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-8450|RXN-7784}} |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-7922}} |
| − | {{#set: produced by=RXN- | + | |
Revision as of 20:33, 17 March 2018
Contents
Metabolite CPD-7087
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
- inchi key:
- InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
- common name:
- (+)-dihydromyricetin
- molecular weight:
- 319.247
- Synonym(s):
- (+)-ampelopsin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.
