Difference between revisions of "RXN-12056"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...")
 
(Created page with "Category:Gene == Gene Ec-11_000400 == * left end position: ** 426877 * transcription direction: ** POSITIVE * right end position: ** 433925 * centisome position: ** 6.7869...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+
== Gene Ec-11_000400 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
+
** 426877
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** icosapentaenoate
+
** 433925
−
* molecular weight:
+
* centisome position:
−
** 301.448    
+
** 6.7869673    
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
+
** Esi_0113_0051
−
** timnodonic acid
+
** Esi0113_0051
−
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
+
** MEP2
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
+
−
** EPA
+
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
+
−
** eicosapentaenoate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12978]]
+
* [[RXN-9839]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-16139]]
+
***automated-name-match
−
* [[RXN-13431]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-6082]]
 +
* [[PWY-6073]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=426877}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=433925}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562]
+
{{#set: centisome position=6.7869673   }}
−
* Wikipedia : Eicosapentaenoate
+
{{#set: common name=Esi_0113_0051|Esi0113_0051|MEP2}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-9839}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428]
+
{{#set: pathway associated=PWY-6082|PWY-6073}}
−
* HMDB : HMDB01999
+
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}}
+
−
{{#set: common name=icosapentaenoate}}
+
−
{{#set: molecular weight=301.448   }}
+
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}}
+
−
{{#set: consumed by=RXN-12978}}
+
−
{{#set: produced by=RXN-16139|RXN-13431}}
+

Revision as of 20:35, 17 March 2018

Gene Ec-11_000400

  • left end position:
    • 426877
  • transcription direction:
    • POSITIVE
  • right end position:
    • 433925
  • centisome position:
    • 6.7869673
  • Synonym(s):
    • Esi_0113_0051
    • Esi0113_0051
    • MEP2

Reactions associated

  • RXN-9839
    • esiliculosus_genome
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12056&oldid=9546"