Difference between revisions of "Ec-24 000620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] == * common name...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] ==
* smiles:
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
+
 
* common name:
 
* common name:
** cathasterone
+
** a [mitogen-activated protein kinase]-L-threonine
* molecular weight:
+
** 432.685   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-715]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.7.12.2-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [mitogen-activated protein kinase]-L-threonine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203118 25203118]
+
{{#set: reversible reaction associated=2.7.12.2-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
+
{{#set: common name=cathasterone}}
+
{{#set: molecular weight=432.685    }}
+
{{#set: produced by=RXN-715}}
+

Revision as of 20:36, 17 March 2018

Metabolite Mitogen-Activated-Protein-Kinase-L-Thr

  • common name:
    • a [mitogen-activated protein kinase]-L-threonine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [mitogen-activated protein kinase]-L-threonine" cannot be used as a page name in this wiki.