Difference between revisions of "Ec-19 003290"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
 
(Created page with "Category:Gene == Gene Ec-04_002870 == * left end position: ** 2996316 * transcription direction: ** NEGATIVE * right end position: ** 3001776 * centisome position: ** 46.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Gene Ec-04_002870 ==
−
* smiles:
+
* left end position:
−
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
** 2996316
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** bisorganyltrisulfane
+
** 3001776
−
* molecular weight:
+
* centisome position:
−
** 644.686    
+
** 46.01328    
 
* Synonym(s):
 
* Synonym(s):
−
** GS3G
+
** Esi_0201_0013
 +
** Esi0201_0013
 +
** Fe/Mn SOD
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[SUPEROX-DISMUT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-10851]]
+
***ec-number
 +
== Pathways associated ==
 +
* [[DETOX1-PWY-1]]
 +
* [[PWY-6854]]
 +
* [[DETOX1-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2996316}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: right end position=3001776}}
−
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: centisome position=46.01328   }}
−
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: common name=Esi_0201_0013|Esi0201_0013|Fe/Mn SOD}}
−
{{#set: molecular weight=644.686   }}
+
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
−
{{#set: common name=GS3G}}
+
{{#set: pathway associated=DETOX1-PWY-1|PWY-6854|DETOX1-PWY}}
−
{{#set: consumed or produced by=RXN-10851}}
+

Revision as of 20:36, 17 March 2018

Gene Ec-04_002870

  • left end position:
    • 2996316
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3001776
  • centisome position:
    • 46.01328
  • Synonym(s):
    • Esi_0201_0013
    • Esi0201_0013
    • Fe/Mn SOD

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_003290&oldid=9624"