Difference between revisions of "ACETYL-COA-CARBOXYLTRANSFER-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-20...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
* inchi key:
+
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
** mycothiol biosynthesis
* molecular weight:
+
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-14:1-Δ7-CoA
+
** MSH biosynthesis
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17794]]
+
'''2''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
* [[RXN-17793]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-06_001090]]
 +
*** [[Ec-26_005440]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN1G-121]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_001440]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11015 RXN-11015]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6501 RXN-6501]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2 RXN1G-2]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4 RXN1G-4]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-201174}}
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
{{#set: common name=mycothiol biosynthesis}}
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: common name=MSH biosynthesis}}
{{#set: molecular weight=987.845    }}
+
{{#set: reaction found=2}}
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: total reaction=6}}
{{#set: consumed by=RXN-17794}}
+
{{#set: completion rate=33.0}}
{{#set: produced by=RXN-17793}}
+

Revision as of 20:38, 17 March 2018

Pathway PWY1G-0

  • taxonomic range:
  • common name:
    • mycothiol biosynthesis
  • Synonym(s):
    • MSH biosynthesis

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links