Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylic-esters Carboxylic-esters] == * common name: ** a carboxylic ester * Synonym(s): ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 7-dehydrodesmosterol |
+ | * molecular weight: | ||
+ | ** 382.628 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5α-cholesta-5,7,24-trien-3β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-27]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11887]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986129 50986129] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107] | ||
+ | * HMDB : HMDB03896 | ||
+ | {{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}} | ||
+ | {{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}} | ||
+ | {{#set: common name=7-dehydrodesmosterol}} | ||
+ | {{#set: molecular weight=382.628 }} | ||
+ | {{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}} | ||
+ | {{#set: consumed by=RXN66-27}} | ||
+ | {{#set: produced by=RXN-11887}} |
Revision as of 21:38, 17 March 2018
Contents
Metabolite CPD-8646
- smiles:
- CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
- inchi key:
- InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
- common name:
- 7-dehydrodesmosterol
- molecular weight:
- 382.628
- Synonym(s):
- 5α-cholesta-5,7,24-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.