Difference between revisions of "RXN-2543"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_010130 == * left end position: ** 7922806 * transcription direction: ** POSITIVE * right end position: ** 7935172 * centisome position: ** 90.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == * smiles: ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6)))))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M |
| − | * | + | * common name: |
| − | ** | + | ** pheophorbide a |
| − | * | + | * molecular weight: |
| − | ** | + | ** 590.677 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** pheide a |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17252]] |
| − | * | + | * [[RXN-7740]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658422 90658422] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4481064.html 4481064] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687] |
| − | + | * LIGAND-CPD: | |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021] | ||
| + | {{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}} | ||
| + | {{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}} | ||
| + | {{#set: common name=pheophorbide a}} | ||
| + | {{#set: molecular weight=590.677 }} | ||
| + | {{#set: common name=pheide a}} | ||
| + | {{#set: consumed by=RXN-17252|RXN-7740}} | ||
Revision as of 20:38, 17 March 2018
Contents
Metabolite CPD-7061
- smiles:
- C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
- inchi key:
- InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
- common name:
- pheophorbide a
- molecular weight:
- 590.677
- Synonym(s):
- pheide a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))" cannot be used as a page name in this wiki.
