Difference between revisions of "CPD-8646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5483 PWY-5483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-554915 TAX-554915]
+
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
 +
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
 
* common name:
 
* common name:
−
** pyruvate fermentation to acetate III
+
** ω-saturated C55 dolichol phosphate
 +
* molecular weight:
 +
** 849.311   
 
* Synonym(s):
 
* Synonym(s):
 +
** ω-saturated dolichol-11 phosphate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-16602]]
−
* [[PYRUFLAVREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-ADP-FORMING-RXN ACETATE--COA-LIGASE-ADP-FORMING-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5535 PWY-5535]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5535 PWY-5535]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-554915}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2157}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
−
{{#set: common name=pyruvate fermentation to acetate III}}
+
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
−
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
−
{{#set: reaction not found=4}}
+
{{#set: common name=ω-saturated C55 dolichol phosphate}}
−
{{#set: completion rate=25.0}}
+
{{#set: molecular weight=849.311    }}
 +
{{#set: common name=ω-saturated dolichol-11 phosphate}}
 +
{{#set: consumed by=RXN-16602}}

Revision as of 20:39, 17 March 2018

Metabolite CPD-17858

  • smiles:
    • CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
  • inchi key:
    • InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
  • common name:
    • ω-saturated C55 dolichol phosphate
  • molecular weight:
    • 849.311
  • Synonym(s):
    • ω-saturated dolichol-11 phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8646&oldid=9785"