Difference between revisions of "CPD-18550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
 
(Created page with "Category:Gene == Gene Ec-12_007000 == * left end position: ** 6310488 * transcription direction: ** NEGATIVE * right end position: ** 6324376 * centisome position: ** 75.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
+
== Gene Ec-12_007000 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
+
** 6310488
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7-dehydrodesmosterol
+
** 6324376
−
* molecular weight:
+
* centisome position:
−
** 382.628    
+
** 75.70116    
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholesta-5,7,24-trien-3β-ol
+
** Esi_0226_0014
 +
** Esi0226_0014
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-27]]
+
* [[3.2.1.23-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-11887]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[BETAGALACTOSID-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[KETOLACTOSE-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-12398]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-12399]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-12400]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-6807]]
 +
* [[BGALACT-PWY]]
 +
* [[LACTOSEUTIL-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6310488}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986129 50986129]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=6324376}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
+
{{#set: centisome position=75.70116   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0226_0014|Esi0226_0014}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
+
{{#set: reaction associated=3.2.1.23-RXN|BETAGALACTOSID-RXN|KETOLACTOSE-RXN|RXN-12398|RXN-12399|RXN-12400}}
−
* HMDB : HMDB03896
+
{{#set: pathway associated=PWY-6807|BGALACT-PWY|LACTOSEUTIL-PWY}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
+
−
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
+
−
{{#set: common name=7-dehydrodesmosterol}}
+
−
{{#set: molecular weight=382.628   }}
+
−
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
+
−
{{#set: consumed by=RXN66-27}}
+
−
{{#set: produced by=RXN-11887}}
+

Revision as of 20:39, 17 March 2018

Gene Ec-12_007000

  • left end position:
    • 6310488
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6324376
  • centisome position:
    • 75.70116
  • Synonym(s):
    • Esi_0226_0014
    • Esi0226_0014

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18550&oldid=9787"