Difference between revisions of "CPD-14268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == * smiles: ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12322 RXN-12322] == * direction: ** LEFT-TO-RIGHT * common name: ** Protein phosphatase methyle...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12322 RXN-12322] ==
* smiles:
+
* direction:
** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
+
 
* common name:
 
* common name:
** pheophorbide a
+
** Protein phosphatase methylesterase, eukaryotic
* molecular weight:
+
* ec number:
** 590.677   
+
** [http://enzyme.expasy.org/EC/3.1.1.89 EC-3.1.1.89]
 
* Synonym(s):
 
* Synonym(s):
** pheide a
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17252]]
+
* With identifiers:
* [[RXN-7740]]
+
** 1 [[Phosphatase-2A-leucine-methyl-ester]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Phosphatase-2A-leucine]][c] '''+''' 1 [[METOH]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a [phosphatase 2A protein] C-terminal L-leucine methyl ester[c] '''+''' 1 H2O[c] '''=>''' 1 a [phosphatase 2A protein] C-terminal L-leucine[c] '''+''' 1 methanol[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-19_001900]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658422 90658422]
+
{{#set: common name=Protein phosphatase methylesterase, eukaryotic}}
* CHEMSPIDER:
+
{{#set: ec number=EC-3.1.1.89}}
** [http://www.chemspider.com/Chemical-Structure.4481064.html 4481064]
+
{{#set: gene associated=Ec-19_001900}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021]
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}}
+
{{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}}
+
{{#set: common name=pheophorbide a}}
+
{{#set: molecular weight=590.677    }}
+
{{#set: common name=pheide a}}
+
{{#set: consumed by=RXN-17252|RXN-7740}}
+

Revision as of 20:39, 17 March 2018

Reaction RXN-12322

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Protein phosphatase methylesterase, eukaryotic
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links