Difference between revisions of "PWY-7147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
 
(Created page with "Category:Gene == Gene Ec-16_003710 == * left end position: ** 3830686 * transcription direction: ** NEGATIVE * right end position: ** 3840068 * centisome position: ** 71.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Gene Ec-16_003710 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** 3830686
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ω-saturated C55 dolichol phosphate
+
** 3840068
−
* molecular weight:
+
* centisome position:
−
** 849.311    
+
** 71.76722    
 
* Synonym(s):
 
* Synonym(s):
−
** ω-saturated dolichol-11 phosphate
+
** Esi_0167_0014
 +
** Esi0167_0014
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16602]]
+
* [[RXN-12086]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[RXN-12579]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[LIPAS-PWY]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3830686}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: right end position=3840068}}
−
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: centisome position=71.76722   }}
−
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: common name=Esi_0167_0014|Esi0167_0014}}
−
{{#set: molecular weight=849.311   }}
+
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
−
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
−
{{#set: consumed by=RXN-16602}}
+

Revision as of 20:39, 17 March 2018

Gene Ec-16_003710

  • left end position:
    • 3830686
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3840068
  • centisome position:
    • 71.76722
  • Synonym(s):
    • Esi_0167_0014
    • Esi0167_0014

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7147&oldid=9824"