Difference between revisions of "RNA-3-PHOSPHATE-CYCLASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5320 PWY-5320] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-37...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5320 PWY-5320] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-3700] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** kaempferol glycoside biosynthesis (Arabidopsis) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''11''' reactions in the full pathway |
− | * [[RXN- | + | * [[RXN1F-461]] |
− | == | + | ** 2 associated gene(s): |
+ | *** [[Ec-14_000870]] | ||
+ | *** [[Ec-04_004610]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13830 RXN-13830] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14008 RXN-14008] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14009 RXN-14009] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8263 RXN-8263] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8266 RXN-8266] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8270 RXN-8270] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8289 RXN-8289] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-443 RXN1F-443] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-474 RXN1F-474] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-475 RXN1F-475] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5320 PWY-5320] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-3700}} |
− | + | {{#set: common name=kaempferol glycoside biosynthesis (Arabidopsis)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=9.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:40, 17 March 2018
Pathway PWY-5320
- taxonomic range:
- common name:
- kaempferol glycoside biosynthesis (Arabidopsis)
- Synonym(s):
Reaction(s) found
1 reactions found over 11 reactions in the full pathway
- RXN1F-461
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: