Difference between revisions of "PWY-5947"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GRSZFWQUAKGDAV-KQYNXXCUSA-L |
* common name: | * common name: | ||
| − | ** | + | ** IMP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 346.193 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5'-IMP |
| − | ** | + | ** ribosylhypoxanthine monophosphate |
| − | ** | + | ** inosinate |
| − | ** | + | ** inosine monophosphate |
| − | ** | + | ** inosine 5'-monophosphate |
| + | ** inosine 5'-phosphate | ||
| + | ** 5'-inosinate | ||
| + | ** 5'-inosinic acid | ||
| + | ** 5'-inosine monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7607]] |
| + | * [[ADENYLOSUCCINATE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[AMP-DEAMINASE-RXN]] | ||
| + | * [[GMP-REDUCT-RXN]] | ||
| + | * [[RXN-14003]] | ||
| + | * [[RXN0-6382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[HYPOXANPRIBOSYLTRAN-RXN]] | ||
| + | * [[IMPCYCLOHYDROLASE-RXN]] | ||
| + | * [[IMP-DEHYDROG-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CAS : 131-99-7 |
| − | {{#set: inchi key=InChIKey= | + | * BIGG : 33960 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140378 7140378] |
| − | {{#set: common name= | + | * HMDB : HMDB00175 |
| − | {{#set: consumed by=RXN- | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00130 C00130] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5482599.html 5482599] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58053 58053] | ||
| + | * METABOLIGHTS : MTBLC58053 | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| + | {{#set: inchi key=InChIKey=GRSZFWQUAKGDAV-KQYNXXCUSA-L}} | ||
| + | {{#set: common name=IMP}} | ||
| + | {{#set: molecular weight=346.193 }} | ||
| + | {{#set: common name=5'-IMP|ribosylhypoxanthine monophosphate|inosinate|inosine monophosphate|inosine 5'-monophosphate|inosine 5'-phosphate|5'-inosinate|5'-inosinic acid|5'-inosine monophosphate}} | ||
| + | {{#set: consumed by=RXN-7607|ADENYLOSUCCINATE-SYNTHASE-RXN}} | ||
| + | {{#set: produced by=AMP-DEAMINASE-RXN|GMP-REDUCT-RXN|RXN-14003|RXN0-6382}} | ||
| + | {{#set: reversible reaction associated=HYPOXANPRIBOSYLTRAN-RXN|IMPCYCLOHYDROLASE-RXN|IMP-DEHYDROG-RXN}} | ||
Revision as of 20:40, 17 March 2018
Contents
Metabolite IMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=GRSZFWQUAKGDAV-KQYNXXCUSA-L
- common name:
- IMP
- molecular weight:
- 346.193
- Synonym(s):
- 5'-IMP
- ribosylhypoxanthine monophosphate
- inosinate
- inosine monophosphate
- inosine 5'-monophosphate
- inosine 5'-phosphate
- 5'-inosinate
- 5'-inosinic acid
- 5'-inosine monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 131-99-7
- BIGG : 33960
- PUBCHEM:
- HMDB : HMDB00175
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58053
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
