Difference between revisions of "2.4.1.151-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...")
 
(Created page with "Category:Gene == Gene Ec-27_001950 == * left end position: ** 1652132 * transcription direction: ** POSITIVE * right end position: ** 1661607 * centisome position: ** 25.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
+
== Gene Ec-27_001950 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
+
** 1652132
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-carboxy-L-xylonolactone
+
** 1661607
−
* molecular weight:
+
* centisome position:
−
** 191.117    
+
** 25.614819    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0036_0051
 +
** Esi0036_0051
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12871]]
+
* [[RXN0-2381]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-12870]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[RXN0-2382]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[TRYPSYN-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 +
* [[PWY-6949]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1652132}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
+
{{#set: right end position=1661607}}
−
{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+
{{#set: centisome position=25.614819    }}
−
{{#set: common name=2-carboxy-L-xylonolactone}}
+
{{#set: common name=Esi_0036_0051|Esi0036_0051}}
−
{{#set: molecular weight=191.117    }}
+
{{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
−
{{#set: consumed by=RXN-12871}}
+
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
−
{{#set: produced by=RXN-12870}}
+

Revision as of 20:41, 17 March 2018

Gene Ec-27_001950

  • left end position:
    • 1652132
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1661607
  • centisome position:
    • 25.614819
  • Synonym(s):
    • Esi_0036_0051
    • Esi0036_0051

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.4.1.151-RXN&oldid=9934"