Difference between revisions of "Ec-27 001950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UROPORIIIMETHYLTRANSA-RXN UROPORIIIMETHYLTRANSA-RXN] == * direction: ** LEFT-TO-RIGHT * common name...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UROPORIIIMETHYLTRANSA-RXN UROPORIIIMETHYLTRANSA-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(C(C(C(C([O-])=O)O)O)O)O)O
 +
* inchi key:
 +
** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
 
* common name:
 
* common name:
−
** Tetrapyrrole methylase, subdomain 2
+
** aldehydo-L-galactonate
 +
* molecular weight:
 +
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
−
** uroporphyrinogen methyltransferase
 
−
** uroporphyrinogen-III methyltransferase
 
−
** adenosylmethionine-uroporphyrinogen III methyltransferase
 
−
** S-adenosyl-L-methionine-dependent uroporphyrinogen III methylase
 
−
** SirA
 
−
** CysG
 
−
** uroporphyrin-III C-methyltransferase (incorrect)
 
−
** S-adenosyl-L-methionine:uroporphyrin-III C-methyltransferase (incorrect)
 
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[UROPORPHYRINOGEN-III]][c] '''=>''' 1 [[CPD-9038]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-11152]]
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 uroporphyrinogen-III[c] '''=>''' 1 precorrin-1[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_004170]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7376]], cob(II)yrinate a,c-diamide biosynthesis II (late cobalt incorporation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7376 PWY-7376]
+
−
** '''2''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-7377]], cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377]
+
−
** '''3''' reactions found over '''15''' reactions in the full pathway
+
−
* [[PWY-5194]], siroheme biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5194 PWY-5194]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5196]], factor 430 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5196 PWY-5196]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19089 19089]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07237 R07237]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : 3138483
−
{{#set: common name=Tetrapyrrole methylase, subdomain 2}}
+
* LIGAND-CPD:
−
{{#set: common name=uroporphyrinogen methyltransferase|uroporphyrinogen-III methyltransferase|adenosylmethionine-uroporphyrinogen III methyltransferase|S-adenosyl-L-methionine-dependent uroporphyrinogen III methylase|SirA|CysG|uroporphyrin-III C-methyltransferase (incorrect)|S-adenosyl-L-methionine:uroporphyrin-III C-methyltransferase (incorrect)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930]
−
{{#set: gene associated=Ec-06_004170}}
+
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}}
−
{{#set: in pathway=PWY-7376|PWY-7377|PWY-5194|PWY-5196}}
+
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=aldehydo-L-galactonate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=195.149    }}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: reversible reaction associated=RXN-11152}}

Revision as of 20:41, 17 March 2018

Metabolite CPD0-1083

  • smiles:
    • C(C(C(C(C(C([O-])=O)O)O)O)O)O
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
  • common name:
    • aldehydo-L-galactonate
  • molecular weight:
    • 195.149
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(C([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_001950&oldid=9938"