Difference between revisions of "3-SULFINOALANINE-AMINOTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_001140 == * left end position: ** 1113431 * transcription direction: ** NEGATIVE * right end position: ** 1131168 * centisome position: ** 16.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M |
− | * | + | * common name: |
− | ** | + | ** cis-coumarinic acid-β-D-glucoside |
− | * | + | * molecular weight: |
− | ** | + | ** 325.294 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** coumarinic acid glucoside |
− | ** | + | ** coumarinate glucoside |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8036]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223] |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113] |
+ | * HMDB : HMDB60077 | ||
+ | {{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}} | ||
+ | {{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}} | ||
+ | {{#set: common name=cis-coumarinic acid-β-D-glucoside}} | ||
+ | {{#set: molecular weight=325.294 }} | ||
+ | {{#set: common name=coumarinic acid glucoside|coumarinate glucoside}} | ||
+ | {{#set: consumed by=RXN-8036}} |
Revision as of 20:42, 17 March 2018
Contents
Metabolite CPD-7417
- smiles:
- C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
- inchi key:
- InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
- common name:
- cis-coumarinic acid-β-D-glucoside
- molecular weight:
- 325.294
- Synonym(s):
- coumarinic acid glucoside
- coumarinate glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.