Difference between revisions of "1-L-MYO-INOSITOL-1-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-25_003640 == * Synonym(s): ** Esi_0378_0021 ** Esi0378_0021 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == |
+ | * smiles: | ||
+ | ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L | ||
+ | * common name: | ||
+ | ** 1D-myo-inositol 3-monophosphate | ||
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-L-myo-inositol-1-p |
− | ** | + | ** L-myo-inositol 1-phosphate |
+ | ** inositol 1-phosphate | ||
+ | ** myo-inositol 1-phosphate | ||
+ | ** 1D-myo-inositol 3-phosphate | ||
+ | ** Ins(3)P1 | ||
+ | ** D-myo-inositol (3)-monophosphate | ||
+ | ** myo-inositol 1-monophosphate | ||
+ | ** Ins3P | ||
+ | ** 1L-myo-inositol 1-phosphate | ||
+ | ** myo-inositol phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] | |
− | * [[ | + | * [[RXN66-579]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288700 5288700] |
− | {{#set: | + | * HMDB : HMDB06814 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04006 C04006] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.16744087.html 16744087] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58401 58401] | ||
+ | * METABOLIGHTS : MTBLC58401 | ||
+ | {{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L}} | ||
+ | {{#set: common name=1D-myo-inositol 3-monophosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=1-L-myo-inositol-1-p|L-myo-inositol 1-phosphate|inositol 1-phosphate|myo-inositol 1-phosphate|1D-myo-inositol 3-phosphate|Ins(3)P1|D-myo-inositol (3)-monophosphate|myo-inositol 1-monophosphate|Ins3P|1L-myo-inositol 1-phosphate|myo-inositol phosphate}} | ||
+ | {{#set: consumed by=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN}} | ||
+ | {{#set: produced by=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579}} |
Latest revision as of 20:58, 21 March 2018
Contents
Metabolite 1-L-MYO-INOSITOL-1-P
- smiles:
- C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
- inchi key:
- InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L
- common name:
- 1D-myo-inositol 3-monophosphate
- molecular weight:
- 258.121
- Synonym(s):
- 1-L-myo-inositol-1-p
- L-myo-inositol 1-phosphate
- inositol 1-phosphate
- myo-inositol 1-phosphate
- 1D-myo-inositol 3-phosphate
- Ins(3)P1
- D-myo-inositol (3)-monophosphate
- myo-inositol 1-monophosphate
- Ins3P
- 1L-myo-inositol 1-phosphate
- myo-inositol phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB06814
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58401
"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.