Difference between revisions of "1-PALMITOYLGLYCEROL-3-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6562 PWY-6562] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-641 TAX-641...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6562 PWY-6562] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-641 TAX-641] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** norspermidine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sym-norspermidine biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''6''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Ec-01_007470]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ASPARTATEKIN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-11_000830]] | ||
+ | *** [[Ec-13_002530]] | ||
+ | *** [[Ec-27_003730]] | ||
+ | *** [[Ec-24_000610]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=4.1.1.86-RXN 4.1.1.86-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R101-RXN R101-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11565 RXN-11565] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9380 RXN-9380] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-641}} | |
− | + | {{#set: common name=norspermidine biosynthesis}} | |
− | + | {{#set: common name=sym-norspermidine biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:57, 17 March 2018
Pathway PWY-6562
- taxonomic range:
- common name:
- norspermidine biosynthesis
- Synonym(s):
- sym-norspermidine biosynthesis
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- ASPARTATEKIN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated: