Difference between revisions of "2-ACETO-LACTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == |
| + | * smiles: | ||
| + | ** CC(=O)C(C)(O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-2-acetolactate |
| + | * molecular weight: | ||
| + | ** 131.108 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (S)-2-hydroxy-2-methyl-3-oxobutanoate | ||
| + | ** α-acetolactate | ||
| + | ** (2S)-2-hydroxy-2-methyl-3-oxobutanoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-6081]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETOLACTSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ACETOLACTREDUCTOISOM-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770] |
| − | {{#set: produced by=RXN- | + | * HMDB : HMDB06855 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476] | ||
| + | * BIGG : 109372 | ||
| + | {{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}} | ||
| + | {{#set: common name=(S)-2-acetolactate}} | ||
| + | {{#set: molecular weight=131.108 }} | ||
| + | {{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}} | ||
| + | {{#set: consumed by=RXN-6081}} | ||
| + | {{#set: produced by=ACETOLACTSYN-RXN}} | ||
| + | {{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN}} | ||
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite 2-ACETO-LACTATE
- smiles:
- CC(=O)C(C)(O)C(=O)[O-]
- inchi key:
- InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
- common name:
- (S)-2-acetolactate
- molecular weight:
- 131.108
- Synonym(s):
- (S)-2-hydroxy-2-methyl-3-oxobutanoate
- α-acetolactate
- (2S)-2-hydroxy-2-methyl-3-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB06855
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 109372
"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.
