Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17252 RXN-17252] == * direction: ** LEFT-TO-RIGHT * common name: ** Pheophorbide a oxygenase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17252 RXN-17252] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
 +
* inchi key:
 +
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** Pheophorbide a oxygenase
+
** 2-(α-hydroxyethyl)thiamine diphosphate
 +
* molecular weight:
 +
** 466.341   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(α-hydroxyethyl)-TPP
 +
** 2-(α-hydroxyethyl)-ThPP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12508]]
−
** 2 [[PROTON]][c] '''+''' 1 [[CPD-7061]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-18666]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-12583]]
−
** 2 H+[c] '''+''' 1 pheophorbide a[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 oxygen[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 epoxypheophorbide a[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-14_003590]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
* Gene: [[Ec-03_003240]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5098]], chlorophyll a degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5098 PWY-5098]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6927]], chlorophyll a degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6927 PWY-6927]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Pheophorbide a oxygenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
−
{{#set: gene associated=Ec-14_003590|Ec-03_003240}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5098|PWY-6927}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
 +
{{#set: molecular weight=466.341    }}
 +
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
 +
{{#set: consumed by=RXN-12508}}
 +
{{#set: produced by=RXN-12583}}

Latest revision as of 20:43, 21 March 2018

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • smiles:
    • CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
  • inchi key:
    • InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
  • common name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • molecular weight:
    • 466.341
  • Synonym(s):
    • 2-(α-hydroxyethyl)-TPP
    • 2-(α-hydroxyethyl)-ThPP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2-ALPHA-HYDROXYETHYL-THPP&oldid=28920"