Difference between revisions of "2-DEOXYRIBOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-beta-Xylan 1-4-beta-Xylan] == * common name: ** a (1→4)-β-D-xylan * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-4-beta-Xylan 1-4-beta-Xylan] ==
* smiles:
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
+
 
* common name:
 
* common name:
** 3-oxo-24-ethyl-cholest-5-ene
+
** a (1→4)-β-D-xylan
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.1.8-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12789]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (1→4)-β-D-xylan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
+
{{#set: consumed by=3.2.1.8-RXN}}
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
+
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: produced by=RXN-12789}}
+

Revision as of 23:06, 17 March 2018

Metabolite 1-4-beta-Xylan

  • common name:
    • a (1→4)-β-D-xylan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links