Difference between revisions of "2-Hexadecenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] == * common name: ** a trans hexadecenoyl-[acp] * Syno...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a trans hexadecenoyl-[acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a trans hexadec-2-enoyl-[acyl-carrier protein] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9663]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[4.2.1.61-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a trans hexadecenoyl-[acp]}} | |
− | + | {{#set: common name=a trans hexadec-2-enoyl-[acyl-carrier protein]}} | |
− | + | {{#set: consumed by=RXN-9663}} | |
− | + | {{#set: produced by=4.2.1.61-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite 2-Hexadecenoyl-ACPs
- common name:
- a trans hexadecenoyl-[acp]
- Synonym(s):
- a trans hexadec-2-enoyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a trans hexadecenoyl-[acp" cannot be used as a page name in this wiki.
"a trans hexadec-2-enoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.