Difference between revisions of "2.7.1.139-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * smiles: ** CCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=GHVNFZFCNZKVNT-U...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Donor-H2 Donor-H2] == * common name: ** an reduced unknown electron acceptor * Synonym(s): ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Donor-H2 Donor-H2] ==
−
* smiles:
+
−
** CCCCCCCCCC(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** decanoate
+
** an reduced unknown electron acceptor
−
* molecular weight:
+
−
** 171.259   
+
 
* Synonym(s):
 
* Synonym(s):
−
** caprate
+
** a reduced unknown electron donor
−
** decanoic acid
+
** A(H2)
−
** n-decanoate
+
−
** n-capric acid
+
−
** caprinic acid
+
−
** caprinate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13614]]
+
* [[RXN0-5063]]
 +
* [[RXN-12473]]
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 +
* [[RXN0-2023]]
 +
* [[R07063]]
 +
* [[RXN-8667]]
 +
* [[RXN-13445]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10981]]
 +
* [[THIOREDOXIN-RXN]]
 +
* [[RXN-6081]]
 +
* [[RXN-14642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13682]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[CHD-RXN]]
 +
* [[R07861]]
 +
* [[RXN-14480]]
 +
* [[RXN-10851]]
 +
* [[RXN-11334]]
 
== External links  ==
 
== External links  ==
−
* CAS : 334-48-5
+
{{#set: common name=an reduced unknown electron acceptor}}
−
* BIGG : 37897
+
{{#set: common name=a reduced unknown electron donor|A(H2)}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN0-5063|RXN-12473|DEOXYHYPUSINE-MONOOXYGENASE-RXN|RXN0-2023|R07063|RXN-8667|RXN-13445}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4678093 4678093]
+
{{#set: produced by=RXN-10981|THIOREDOXIN-RXN|RXN-6081|RXN-14642}}
−
* HMDB : HMDB00511
+
{{#set: reversible reaction associated=RXN-13682|NADH-DEHYDROGENASE-RXN|ADENYLYLSULFATE-REDUCTASE-RXN|CHD-RXN|R07861|RXN-14480|RXN-10851|RXN-11334}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01571 C01571]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.3866366.html 3866366]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27689 27689]
+
−
* METABOLIGHTS : MTBLC27689
+
−
{{#set: smiles=CCCCCCCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M}}
+
−
{{#set: common name=decanoate}}
+
−
{{#set: molecular weight=171.259    }}
+
−
{{#set: common name=caprate|decanoic acid|n-decanoate|n-capric acid|caprinic acid|caprinate}}
+
−
{{#set: consumed by=RXN-13614}}
+

Revision as of 14:47, 21 March 2018

Metabolite Donor-H2

  • common name:
    • an reduced unknown electron acceptor
  • Synonym(s):
    • a reduced unknown electron donor
    • A(H2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.7.1.139-RXN&oldid=21670"