Difference between revisions of "2.7.13.3-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.13.3-RXN 2.7.13.3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Phytochrome-like prot...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.13.3-RXN 2.7.13.3-RXN] ==
−
* smiles:
+
* direction:
−
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HMLZLHKHNBLLJD-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 3,7-dimethylurate
+
** Phytochrome-like protein 3
−
* molecular weight:
+
** Histidine kinase-like protein
−
** 196.165   
+
** Histidine kinase-like ATPase, C-terminal domain
 +
** Signal transduction histidine kinase-related protein, C-terminal
 +
** Phytochrome-like protein 2
 +
** Signal transduction response regulator, receiver domain
 +
** CheY-like superfamily
 +
** Phytochrome, central region
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.13.3 EC-2.7.13.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 3,7-dimethyluric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11519]]
+
** 1 [[ATP]][c] '''+''' 1 [[Protein-Histidines]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-phospho-L-histidines]][c] '''+''' 1 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 a [protein]-L-histidine[c] '''=>''' 1 H+[c] '''+''' 1 a [protein]-N-phospho-L-histidine[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_005060]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_003580]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_000050]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-24_003660]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-28_000680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_006760]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_005140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-27_001140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_010160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_006180]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_005110]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=83126 83126]
+
{{#set: common name=Phytochrome-like protein 3}}
−
* HMDB : HMDB01982
+
{{#set: common name=Histidine kinase-like protein}}
−
* LIGAND-CPD:
+
{{#set: common name=Histidine kinase-like ATPase, C-terminal domain}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16360 C16360]
+
{{#set: common name=Signal transduction histidine kinase-related protein, C-terminal}}
−
* CHEMSPIDER:
+
{{#set: common name=Phytochrome-like protein 2}}
−
** [http://www.chemspider.com/Chemical-Structure.74994.html 74994]
+
{{#set: common name=Signal transduction response regulator, receiver domain}}
−
* CHEBI:
+
{{#set: common name=CheY-like superfamily}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68531 68531]
+
{{#set: common name=Phytochrome, central region}}
−
* METABOLIGHTS : MTBLC68531
+
{{#set: ec number=EC-2.7.13.3}}
−
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2))}}
+
{{#set: gene associated=Ec-06_005060|Ec-26_003580|Ec-22_000050|Ec-24_003660|Ec-28_000680|Ec-06_006760|Ec-06_005140|Ec-27_001140|Ec-00_010160|Ec-00_006180|Ec-06_005110}}
−
{{#set: inchi key=InChIKey=HMLZLHKHNBLLJD-UHFFFAOYSA-N}}
+
{{#set: in pathway=}}
−
{{#set: common name=3,7-dimethylurate}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=196.165    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=3,7-dimethyluric acid}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN-11519}}
+

Latest revision as of 20:01, 21 March 2018

Reaction 2.7.13.3-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Phytochrome-like protein 3
    • Histidine kinase-like protein
    • Histidine kinase-like ATPase, C-terminal domain
    • Signal transduction histidine kinase-related protein, C-terminal
    • Phytochrome-like protein 2
    • Signal transduction response regulator, receiver domain
    • CheY-like superfamily
    • Phytochrome, central region
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.7.13.3-RXN&oldid=23967"