Difference between revisions of "2.7.13.3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.13.3-RXN 2.7.13.3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Phytochrome-like prot...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.13.3-RXN 2.7.13.3-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 3, | + | ** Phytochrome-like protein 3 |
− | * | + | ** Histidine kinase-like protein |
− | ** | + | ** Histidine kinase-like ATPase, C-terminal domain |
+ | ** Signal transduction histidine kinase-related protein, C-terminal | ||
+ | ** Phytochrome-like protein 2 | ||
+ | ** Signal transduction response regulator, receiver domain | ||
+ | ** CheY-like superfamily | ||
+ | ** Phytochrome, central region | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.7.13.3 EC-2.7.13.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[Protein-Histidines]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-phospho-L-histidines]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 a [protein]-L-histidine[c] '''=>''' 1 H+[c] '''+''' 1 a [protein]-N-phospho-L-histidine[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_005060]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-26_003580]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-22_000050]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-24_003660]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-28_000680]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_006760]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_005140]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-27_001140]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-00_010160]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-00_006180]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_005110]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Phytochrome-like protein 3}} | |
− | + | {{#set: common name=Histidine kinase-like protein}} | |
− | + | {{#set: common name=Histidine kinase-like ATPase, C-terminal domain}} | |
− | + | {{#set: common name=Signal transduction histidine kinase-related protein, C-terminal}} | |
− | + | {{#set: common name=Phytochrome-like protein 2}} | |
− | + | {{#set: common name=Signal transduction response regulator, receiver domain}} | |
− | + | {{#set: common name=CheY-like superfamily}} | |
− | + | {{#set: common name=Phytochrome, central region}} | |
− | + | {{#set: ec number=EC-2.7.13.3}} | |
− | {{#set: | + | {{#set: gene associated=Ec-06_005060|Ec-26_003580|Ec-22_000050|Ec-24_003660|Ec-28_000680|Ec-06_006760|Ec-06_005140|Ec-27_001140|Ec-00_010160|Ec-00_006180|Ec-06_005110}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 20:01, 21 March 2018
Contents
Reaction 2.7.13.3-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Phytochrome-like protein 3
- Histidine kinase-like protein
- Histidine kinase-like ATPase, C-terminal domain
- Signal transduction histidine kinase-related protein, C-terminal
- Phytochrome-like protein 2
- Signal transduction response regulator, receiver domain
- CheY-like superfamily
- Phytochrome, central region
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 Protein-Histidines[c] => 1 PROTON[c] + 1 Protein-phospho-L-histidines[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 a [protein]-L-histidine[c] => 1 H+[c] + 1 a [protein]-N-phospho-L-histidine[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_005060
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_003580
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-22_000050
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_003660
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-28_000680
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_006760
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_005140
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_001140
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-00_010160
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-00_006180
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_005110
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome