Difference between revisions of "25S-rRNA-adenine-2142"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == |
* smiles: | * smiles: | ||
− | ** C | + | ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L |
* common name: | * common name: | ||
− | ** | + | ** (2S)-2-isopropyl-3-oxosuccinate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 172.137 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-isopropyl-3-oxosuccinate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7800]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[3-ISOPROPYLMALDEHYDROG-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214] |
− | {{#set: common name= | + | * BIGG : 43420 |
− | {{#set: molecular weight= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705] |
− | {{#set: | + | * HMDB : HMDB12149 |
+ | {{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}} | ||
+ | {{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}} | ||
+ | {{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}} | ||
+ | {{#set: molecular weight=172.137 }} | ||
+ | {{#set: common name=2-isopropyl-3-oxosuccinate}} | ||
+ | {{#set: consumed by=RXN-7800}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}} |
Revision as of 22:58, 17 March 2018
Contents
Metabolite CPD-7100
- smiles:
- CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
- inchi key:
- InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
- common name:
- (2S)-2-isopropyl-3-oxosuccinate
- molecular weight:
- 172.137
- Synonym(s):
- 2-isopropyl-3-oxosuccinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.