Difference between revisions of "3-BETA-D-GLUCOSYLGLUCOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] == * common name: ** perillate * Synonym(s): ** perillic acid ** perillyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] ==
 +
* smiles:
 +
** C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
 +
* inchi key:
 +
** InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
 
* common name:
 
* common name:
−
** perillate
+
** nigerose
 +
* molecular weight:
 +
** 342.299   
 
* Synonym(s):
 
* Synonym(s):
−
** perillic acid
+
** α-1,3-glucose disaccharide
−
** perillyl carboxylate
+
** sakebiose
−
** 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
+
** 3-O-α-D-glucopyranosyl-D-glucopyranose
−
** 4-isopropenylcyclohex-1-enecarboxylic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5395]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14280]]
 
 
== External links  ==
 
== External links  ==
−
{{#set: common name=perillate}}
+
* PUBCHEM:
−
{{#set: common name=perillic acid|perillyl carboxylate|4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid|4-isopropenylcyclohex-1-enecarboxylic acid}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439512 439512]
−
{{#set: reversible reaction associated=RXN-14280}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7570 7570]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01518 C01518]
 +
* HMDB : HMDB29882
 +
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)}}
 +
{{#set: inchi key=InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N}}
 +
{{#set: common name=nigerose}}
 +
{{#set: molecular weight=342.299    }}
 +
{{#set: common name=α-1,3-glucose disaccharide|sakebiose|3-O-α-D-glucopyranosyl-D-glucopyranose}}
 +
{{#set: consumed by=RXN0-5395}}

Latest revision as of 20:34, 21 March 2018

Metabolite 3-BETA-D-GLUCOSYLGLUCOSE

  • smiles:
    • C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
  • inchi key:
    • InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
  • common name:
    • nigerose
  • molecular weight:
    • 342.299
  • Synonym(s):
    • α-1,3-glucose disaccharide
    • sakebiose
    • 3-O-α-D-glucopyranosyl-D-glucopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-BETA-D-GLUCOSYLGLUCOSE&oldid=27885"