Difference between revisions of "3-HYDROXYADIPYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_001410 == * left end position: ** 1625212 * transcription direction: ** NEGATIVE * right end position: ** 1662233 * centisome position: ** 8.57...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I |
| − | * | + | * common name: |
| − | ** | + | ** (3S)-hydroxyadipyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 906.621 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | * [[RXN-2425]] | |
| − | + | * [[RXN0-2044]] | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679061 70679061] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70990 70990] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: reaction associated= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14145 C14145] |
| + | * HMDB : HMDB12475 | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I}} | ||
| + | {{#set: common name=(3S)-hydroxyadipyl-CoA}} | ||
| + | {{#set: molecular weight=906.621 }} | ||
| + | {{#set: reversible reaction associated=RXN-2425|RXN0-2044}} | ||
Latest revision as of 20:54, 21 March 2018
Contents
Metabolite 3-HYDROXYADIPYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I
- common name:
- (3S)-hydroxyadipyl-CoA
- molecular weight:
- 906.621
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
