Difference between revisions of "3-OXOACYL-ACP-SYNTH-BASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6993 PWY-6993] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6993 PWY-6993] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nicotine degradation II (pyrrolidine pathway) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''11''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-646]] |
− | * [[1. | + | ** 1 associated gene(s): |
− | == | + | *** [[Ec-26_006010]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.13.11.9-RXN 1.13.11.9-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MALEATE-ISOMERASE-RXN MALEATE-ISOMERASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11318 RXN-11318] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13076 RXN-13076] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13077 RXN-13077] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13081 RXN-13081] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13082 RXN-13082] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13088 RXN-13088] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13089 RXN-13089] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SUCCSEMIALDDEHYDROG-RXN SUCCSEMIALDDEHYDROG-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=nicotine degradation II (pyrrolidine pathway)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=9.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:19, 21 March 2018
Pathway PWY-6993
- taxonomic range:
- common name:
- nicotine degradation II (pyrrolidine pathway)
- Synonym(s):
Reaction(s) found
1 reactions found over 11 reactions in the full pathway
- RXN-646
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 1.13.11.9-RXN
- MALEATE-ISOMERASE-RXN
- RXN-11318
- RXN-13076
- RXN-13077
- RXN-13081
- RXN-13082
- RXN-13088
- RXN-13089
- SUCCSEMIALDDEHYDROG-RXN