Difference between revisions of "3-Oxo-5-Alpha-Steroids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxo-5-Alpha-Steroids 3-Oxo-5-Alpha-Steroids] == * common name: ** a 3-oxo-5-α-steroid *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxo-5-Alpha-Steroids 3-Oxo-5-Alpha-Steroids] ==
* smiles:
+
** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
+
* inchi key:
+
** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
** O-succinyl-L-homoserine
+
** a 3-oxo-5-α-steroid
* molecular weight:
+
** 218.186   
+
 
* Synonym(s):
 
* Synonym(s):
** O-succinyl-homoserine
 
** succinyl-homoserine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[METBALT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMSUCTRAN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-9384]]
+
* [[RXN-13682]]
 +
* [[1.3.99.5-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 1492-23-5
+
{{#set: common name=a 3-oxo-5-α-steroid}}
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-13682|1.3.99.5-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661]
+
* BIGG : 36847
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118]
+
{{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}}
+
{{#set: common name=O-succinyl-L-homoserine}}
+
{{#set: molecular weight=218.186    }}
+
{{#set: common name=O-succinyl-homoserine|succinyl-homoserine}}
+
{{#set: consumed by=O-SUCCHOMOSERLYASE-RXN|METBALT-RXN}}
+
{{#set: produced by=HOMSUCTRAN-RXN}}
+
{{#set: reversible reaction associated=RXN-9384}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite 3-Oxo-5-Alpha-Steroids

  • common name:
    • a 3-oxo-5-α-steroid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links