Difference between revisions of "3-SULFINOALANINE-AMINOTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_001140 == * left end position: ** 1113431 * transcription direction: ** NEGATIVE * right end position: ** 1131168 * centisome position: ** 16.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_001140 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
−
* left end position:
+
* smiles:
−
** 1113431
+
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
−
* right end position:
+
* common name:
−
** 1131168
+
** cis-coumarinic acid-β-D-glucoside
−
* centisome position:
+
* molecular weight:
−
** 16.971926    
+
** 325.294    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0256_0016
+
** coumarinic acid glucoside
−
** Esi0256_0016
+
** coumarinate glucoside
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-8036]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1113431}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
−
{{#set: right end position=1131168}}
+
* CHEBI:
−
{{#set: centisome position=16.971926   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
−
{{#set: common name=Esi_0256_0016|Esi0256_0016}}
+
* PUBCHEM:
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
 +
* HMDB : HMDB60077
 +
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
 +
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
 +
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
 +
{{#set: molecular weight=325.294   }}
 +
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
 +
{{#set: consumed by=RXN-8036}}

Revision as of 21:42, 17 March 2018

Metabolite CPD-7417

  • smiles:
    • C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
  • inchi key:
    • InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
  • common name:
    • cis-coumarinic acid-β-D-glucoside
  • molecular weight:
    • 325.294
  • Synonym(s):
    • coumarinic acid glucoside
    • coumarinate glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-SULFINOALANINE-AMINOTRANSFERASE-RXN&oldid=9995"