Difference between revisions of "3-oxo-behenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] == * common name: ** a 3-oxo-behenoyl-[acp] * Synonym(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 3-oxo-behenoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 3-oxo-behenoyl [acyl-carrier-protein] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-469]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN1G-445]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN1G-157]] |
| + | * [[RXN1G-460]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 3-oxo-behenoyl-[acp]}} | |
| − | + | {{#set: common name=a 3-oxo-behenoyl [acyl-carrier-protein]}} | |
| − | + | {{#set: consumed by=RXN1G-469}} | |
| − | + | {{#set: produced by=RXN1G-445}} | |
| − | + | {{#set: reversible reaction associated=RXN1G-157|RXN1G-460}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:38, 21 March 2018
Contents
Metabolite 3-oxo-behenoyl-ACPs
- common name:
- a 3-oxo-behenoyl-[acp]
- Synonym(s):
- a 3-oxo-behenoyl [acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 3-oxo-behenoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-behenoyl [acyl-carrier-protein" cannot be used as a page name in this wiki.
