Difference between revisions of "3.2.1.106-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] == * smiles: ** [CH](=O)CC1(C=CC(O)=CC=1) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.106-RXN 3.2.1.106-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Mannosyl-oligosacch...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.106-RXN 3.2.1.106-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Mannosyl-oligosaccharide glucosidase, family GH63 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.106 EC-3.2.1.106] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-13936]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[CPD-13937]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 Glc3Man9GlcNAc2[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 Glc2Man9GlcNAc2[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-00_001370]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/O14255 O14255] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http:// | + | {{#set: common name=Mannosyl-oligosaccharide glucosidase, family GH63}} |
− | + | {{#set: ec number=EC-3.2.1.106}} | |
− | + | {{#set: gene associated=Ec-00_001370}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:49, 21 March 2018
Contents
Reaction 3.2.1.106-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Mannosyl-oligosaccharide glucosidase, family GH63
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-13936[c] => 1 Glucopyranose[c] + 1 CPD-13937[c]
- With common name(s):
- 1 H2O[c] + 1 Glc3Man9GlcNAc2[c] => 1 D-glucopyranose[c] + 1 Glc2Man9GlcNAc2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_001370
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT: