Difference between revisions of "4-AMINO-BUTYRALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9632 RXN-9632] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-stearoyl-[acyl-carrier...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9632 RXN-9632] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
 +
* inchi key:
 +
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** 3-oxo-stearoyl-[acyl-carrier protein] synthase
+
** 4-hydroxy-2-nonenal-glutathione conjugate
−
** Beta-ketoacyl synthase, N-terminal
+
* molecular weight:
−
** beta-ketoacyl synthase, partial
+
** 462.537   
−
** Thiolase-like, subgroup
+
−
** 3-oxoacyl-[acyl-carrier-protein] synthase
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[3-oxo-stearoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-13673]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 a palmitoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a 3-oxo-stearoyl-[acp][c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-12_000640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-27_003480]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-27_002090]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-12_000650]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-stearoyl-[acyl-carrier protein] synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
−
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
+
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
−
{{#set: common name=beta-ketoacyl synthase, partial}}
+
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
−
{{#set: common name=Thiolase-like, subgroup}}
+
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
−
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
+
{{#set: molecular weight=462.537    }}
−
{{#set: ec number=EC-2.3.1.41}}
+
{{#set: produced by=RXN-13673}}
−
{{#set: gene associated=Ec-12_000640|Ec-27_003480|Ec-27_002090|Ec-12_000650}}
+
−
{{#set: in pathway=PWY-5989}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 22:28, 17 March 2018

Metabolite CPD-14704

  • smiles:
    • CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
  • inchi key:
    • InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
  • common name:
    • 4-hydroxy-2-nonenal-glutathione conjugate
  • molecular weight:
    • 462.537
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=4-AMINO-BUTYRALDEHYDE&oldid=13151"