Difference between revisions of "4-TRIMETHYLAMMONIOBUTANAL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 T...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1] ==
* smiles:
+
* taxonomic range:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
* inchi key:
+
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
 
* common name:
 
* common name:
** tetrahydrogeranylgeranyl chlorophyll a
+
** glycine betaine degradation II (mammalian)
* molecular weight:
+
** 890.479   
+
 
* Synonym(s):
 
* Synonym(s):
** tetrahydroGG-chlorophyll a
 
** tetrahydroGG-chl a
 
** tetrahydrogeranylgeranyl-chl a
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7666]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLYOHMETRANS-RXN]]
* [[RXN-7665]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-14_004260]]
 +
*** [[Ec-24_002640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-576 RXN66-576]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-577 RXN66-577]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-40674}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: common name=glycine betaine degradation II (mammalian)}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: total reaction=4}}
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: completion rate=25.0}}
{{#set: molecular weight=890.479    }}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
{{#set: consumed by=RXN-7666}}
+
{{#set: produced by=RXN-7665}}
+

Revision as of 14:23, 21 March 2018

Pathway PWY-3661-1

  • taxonomic range:
  • common name:
    • glycine betaine degradation II (mammalian)
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links