Difference between revisions of "5-HYDROXY-CTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN] == * direction: ** LEFT-TO...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
 
* common name:
 
* common name:
−
** Pyruvate/Phosphoenolpyruvate kinase-like domain
+
** 5-hydroxy-CTP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.9.1 EC-2.7.9.1]
+
** 495.126   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxycytidine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[Pi]][c] '''=>''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c]
+
* [[RXN0-7080]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 pyruvate[c] '''+''' 1 phosphate[c] '''=>''' 1 phosphoenolpyruvate[c] '''+''' 1 diphosphate[c] '''+''' 1 H+[c] '''+''' 1 AMP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-18_001310]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-241]], C4 photosynthetic carbon assimilation cycle, NADP-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
+
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10756 10756]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
−
* LIGAND-RXN:
+
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00206 R00206]
+
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
−
* UNIPROT:
+
{{#set: common name=5-hydroxy-CTP}}
−
** [http://www.uniprot.org/uniprot/Q7M0I6 Q7M0I6]
+
{{#set: molecular weight=495.126    }}
−
** [http://www.uniprot.org/uniprot/O23404 O23404]
+
{{#set: common name=5-hydroxycytidine triphosphate}}
−
** [http://www.uniprot.org/uniprot/Q9WYA9 Q9WYA9]
+
{{#set: produced by=RXN0-7080}}
−
** [http://www.uniprot.org/uniprot/P22983 P22983]
+
−
** [http://www.uniprot.org/uniprot/Q41846 Q41846]
+
−
** [http://www.uniprot.org/uniprot/Q42367 Q42367]
+
−
** [http://www.uniprot.org/uniprot/Q42368 Q42368]
+
−
** [http://www.uniprot.org/uniprot/P22221 P22221]
+
−
** [http://www.uniprot.org/uniprot/P37213 P37213]
+
−
** [http://www.uniprot.org/uniprot/Q42736 Q42736]
+
−
** [http://www.uniprot.org/uniprot/Q42910 Q42910]
+
−
** [http://www.uniprot.org/uniprot/Q39734 Q39734]
+
−
** [http://www.uniprot.org/uniprot/Q39735 Q39735]
+
−
** [http://www.uniprot.org/uniprot/O24612 O24612]
+
−
** [http://www.uniprot.org/uniprot/O85840 O85840]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=Pyruvate/Phosphoenolpyruvate kinase-like domain}}
+
−
{{#set: ec number=EC-2.7.9.1}}
+
−
{{#set: gene associated=Ec-18_001310}}
+
−
{{#set: in pathway=PWY-6549|PWY-241|PWY-7117|PWY-7115}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:42, 21 March 2018

Metabolite 5-HYDROXY-CTP

  • smiles:
    • C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
  • common name:
    • 5-hydroxy-CTP
  • molecular weight:
    • 495.126
  • Synonym(s):
    • 5-hydroxycytidine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-HYDROXY-CTP&oldid=28776"