Difference between revisions of "5-HYDROXY-CTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.96-RXN 3.2.1.96-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycoside hydrolase,...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.96-RXN 3.2.1.96-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
 
* common name:
 
* common name:
−
** Glycoside hydrolase, family 85
+
** 5-hydroxy-CTP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.2.1.96 EC-3.2.1.96]
+
** 495.126   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxycytidine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[a-glycopeptide-D-mannosyl-Nsup4sup-N-ace]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-14375]][c] '''+''' 1 [[N-acetyl-D-glucosamine-asparagine]][c]
+
* [[RXN0-7080]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a glycopeptide-D-mannosyl-N4-(N-acetyl-D-glucosaminyl)2-asparagine[c] '''+''' 1 H2O[c] '''=>''' 1 a glycopeptide-D-mannosyl-N4-N-acetyl-D-glucosamine[c] '''+''' 1 N-acetyl-D-glucosamine-asparagine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-10_005260]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P13670 P13670]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
−
** [http://www.uniprot.org/uniprot/P49610 P49610]
+
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
−
** [http://www.uniprot.org/uniprot/Q9CFI4 Q9CFI4]
+
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
−
** [http://www.uniprot.org/uniprot/Q9R5G5 Q9R5G5]
+
{{#set: common name=5-hydroxy-CTP}}
−
** [http://www.uniprot.org/uniprot/P04067 P04067]
+
{{#set: molecular weight=495.126    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=5-hydroxycytidine triphosphate}}
−
{{#set: common name=Glycoside hydrolase, family 85}}
+
{{#set: produced by=RXN0-7080}}
−
{{#set: ec number=EC-3.2.1.96}}
+
−
{{#set: gene associated=Ec-10_005260}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:42, 21 March 2018

Metabolite 5-HYDROXY-CTP

  • smiles:
    • C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
  • common name:
    • 5-hydroxy-CTP
  • molecular weight:
    • 495.126
  • Synonym(s):
    • 5-hydroxycytidine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-HYDROXY-CTP&oldid=28776"