Difference between revisions of "5-HYDROXYINDOLE ACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...")
(Created page with "Category:Gene == Gene Ec-04_002840 == * left end position: ** 2958041 * transcription direction: ** POSITIVE * right end position: ** 2968959 * centisome position: ** 45.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
+
== Gene Ec-04_002840 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 2958041
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
+
** 2968959
−
* molecular weight:
+
* centisome position:
−
** 927.663    
+
** 45.425503    
 
* Synonym(s):
 
* Synonym(s):
−
** 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA
+
** Esi_0201_0005
 +
** Esi0201_0005
 +
** CDPK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11245]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-11244]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2958041}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173446 46173446]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2968959}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73549 73549]
+
{{#set: centisome position=45.425503   }}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: common name=Esi_0201_0005|Esi0201_0005|CDPK}}
−
{{#set: inchi key=InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA}}
+
−
{{#set: molecular weight=927.663   }}
+
−
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA}}
+
−
{{#set: consumed by=RXN-11245}}
+
−
{{#set: produced by=RXN-11244}}
+

Revision as of 14:20, 21 March 2018

Gene Ec-04_002840

  • left end position:
    • 2958041
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2968959
  • centisome position:
    • 45.425503
  • Synonym(s):
    • Esi_0201_0005
    • Esi0201_0005
    • CDPK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-HYDROXYINDOLE_ACETATE&oldid=17738"